C17H20FN3 — CID 139674758
2-(2-fluoro-6-phenylphenyl)-1,1,3,3-tetramethylguanidine (PubChem CID 139674758) has the molecular formula C17H20FN3 and a molecular weight of 285.37 g/mol. Its IUPAC name is 2-(2-fluoro-6-phenylphenyl)-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-(2-fluoro-6-phenylphenyl)-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 139674758 |
| Molecular Formula | C17H20FN3 |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 2-(2-fluoro-6-phenylphenyl)-1,1,3,3-tetramethylguanidine |
| SMILES | CN(C)C(=Nc1c(F)cccc1-c1ccccc1)N(C)C |
| InChI | InChI=1S/C17H20FN3/c1-20(2)17(21(3)4)19-16-14(11-8-12-15(16)18)13-9-6-5-7-10-13/h5-12H,1-4H3 |
| InChIKey | YYHVGZSCMIUCQI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|