C20H23N3O3 — CID 139674777
(2Z)-2-amino-2-[4-methoxy-1-(2-phenylphenyl)piperidin-2-yl]iminoacetic acid (PubChem CID 139674777) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is (2Z)-2-amino-2-[4-methoxy-1-(2-phenylphenyl)piperidin-2-yl]iminoacetic acid.
| Compound Name | (2Z)-2-amino-2-[4-methoxy-1-(2-phenylphenyl)piperidin-2-yl]iminoacetic acid |
|---|---|
| PubChem CID | 139674777 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | (2Z)-2-amino-2-[4-methoxy-1-(2-phenylphenyl)piperidin-2-yl]iminoacetic acid |
| SMILES | COC1CCN(c2ccccc2-c2ccccc2)C(/N=C(\N)C(=O)O)C1 |
| InChI | InChI=1S/C20H23N3O3/c1-26-15-11-12-23(18(13-15)22-19(21)20(24)25)17-10-6-5-9-16(17)14-7-3-2-4-8-14/h2-10,15,18H,11-13H2,1H3,(H2,21,22)(H,24,25) |
| InChIKey | YIVYWLAXGNUMDZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|