C22H33FSi — CID 139675565
3-(4-fluorophenyl)-9-[(E)-hex-3-enyl]-6-silaspiro[5.5]undecane (PubChem CID 139675565) has the molecular formula C22H33FSi and a molecular weight of 344.59 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-9-[(E)-hex-3-enyl]-6-silaspiro[5.5]undecane.
| Compound Name | 3-(4-fluorophenyl)-9-[(E)-hex-3-enyl]-6-silaspiro[5.5]undecane |
|---|---|
| PubChem CID | 139675565 |
| Molecular Formula | C22H33FSi |
| Molecular Weight | 344.59 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | 3-(4-fluorophenyl)-9-[(E)-hex-3-enyl]-6-silaspiro[5.5]undecane |
| SMILES | CC/C=C/CCC1CC[Si]2(CC1)CCC(c1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C22H33FSi/c1-2-3-4-5-6-19-11-15-24(16-12-19)17-13-21(14-18-24)20-7-9-22(23)10-8-20/h3-4,7-10,19,21H,2,5-6,11-18H2,1H3/b4-3+ |
| InChIKey | DMXDKYHPMLENNS-ONEGZZNKSA-N |
| XLogP | 7.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.59 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|