C17H23NO7 — CID 139679987
4-(1-carboxyoctoxycarbonylamino)-2-hydroxybenzoic acid (PubChem CID 139679987) has the molecular formula C17H23NO7 and a molecular weight of 353.37 g/mol. Its IUPAC name is 4-(1-carboxyoctoxycarbonylamino)-2-hydroxybenzoic acid.
| Compound Name | 4-(1-carboxyoctoxycarbonylamino)-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 139679987 |
| Molecular Formula | C17H23NO7 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 4-(1-carboxyoctoxycarbonylamino)-2-hydroxybenzoic acid |
| SMILES | CCCCCCCC(OC(=O)Nc1ccc(C(=O)O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C17H23NO7/c1-2-3-4-5-6-7-14(16(22)23)25-17(24)18-11-8-9-12(15(20)21)13(19)10-11/h8-10,14,19H,2-7H2,1H3,(H,18,24)(H,20,21)(H,22,23) |
| InChIKey | QJCQSKSFMLFKIG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|