C19H27NO6 — CID 139687085
2-amino-3-[2-butoxycarbonyl-4-(2,2-dimethylpropanoyloxy)phenyl]propanoic acid (PubChem CID 139687085) has the molecular formula C19H27NO6 and a molecular weight of 365.43 g/mol. Its IUPAC name is 2-amino-3-[2-butoxycarbonyl-4-(2,2-dimethylpropanoyloxy)phenyl]propanoic acid.
| Compound Name | 2-amino-3-[2-butoxycarbonyl-4-(2,2-dimethylpropanoyloxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 139687085 |
| Molecular Formula | C19H27NO6 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 2-amino-3-[2-butoxycarbonyl-4-(2,2-dimethylpropanoyloxy)phenyl]propanoic acid |
| SMILES | CCCCOC(=O)c1cc(OC(=O)C(C)(C)C)ccc1CC(N)C(=O)O |
| InChI | InChI=1S/C19H27NO6/c1-5-6-9-25-17(23)14-11-13(26-18(24)19(2,3)4)8-7-12(14)10-15(20)16(21)22/h7-8,11,15H,5-6,9-10,20H2,1-4H3,(H,21,22) |
| InChIKey | KEOVLQZMCKEGNW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|