C33H38N2O8 — CID 139687090
butyl 2-[2-amino-3-[2-(2-amino-1-hydroxy-2-oxo-1-phenylethyl)phenoxy]-3-oxopropyl]-5-(2,2-dimethylpropanoyloxy)benzoate (PubChem CID 139687090) has the molecular formula C33H38N2O8 and a molecular weight of 590.67 g/mol. Its IUPAC name is butyl 2-[2-amino-3-[2-(2-amino-1-hydroxy-2-oxo-1-phenylethyl)phenoxy]-3-oxopropyl]-5-(2,2-dimethylpropanoyloxy)benzoate.
| Compound Name | butyl 2-[2-amino-3-[2-(2-amino-1-hydroxy-2-oxo-1-phenylethyl)phenoxy]-3-oxopropyl]-5-(2,2-dimethylpropanoyloxy)benzoate |
|---|---|
| PubChem CID | 139687090 |
| Molecular Formula | C33H38N2O8 |
| Molecular Weight | 590.67 g/mol |
| Exact Mass | 590.26 |
| IUPAC Name | butyl 2-[2-amino-3-[2-(2-amino-1-hydroxy-2-oxo-1-phenylethyl)phenoxy]-3-oxopropyl]-5-(2,2-dimethylpropanoyloxy)benzoate |
| SMILES | CCCCOC(=O)c1cc(OC(=O)C(C)(C)C)ccc1CC(N)C(=O)Oc1ccccc1C(O)(C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C33H38N2O8/c1-5-6-18-41-28(36)24-20-23(42-31(39)32(2,3)4)17-16-21(24)19-26(34)29(37)43-27-15-11-10-14-25(27)33(40,30(35)38)22-12-8-7-9-13-22/h7-17,20,26,40H,5-6,18-19,34H2,1-4H3,(H2,35,38) |
| InChIKey | QSZVTYKEZCXUSD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 168.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.67 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|