C15H14N4 — CID 139688222
15-ethyl-13,14,16,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,12,14-heptaene (PubChem CID 139688222) has the molecular formula C15H14N4 and a molecular weight of 250.31 g/mol. Its IUPAC name is 15-ethyl-13,14,16,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,12,14-heptaene.
| Compound Name | 15-ethyl-13,14,16,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,12,14-heptaene |
|---|---|
| PubChem CID | 139688222 |
| Molecular Formula | C15H14N4 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 15-ethyl-13,14,16,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,12,14-heptaene |
| SMILES | CCc1nnc2cc3c(nn12)-c1ccccc1CC3 |
| InChI | InChI=1S/C15H14N4/c1-2-13-16-17-14-9-11-8-7-10-5-3-4-6-12(10)15(11)18-19(13)14/h3-6,9H,2,7-8H2,1H3 |
| InChIKey | IXIKECDMWDBRPW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |