About 2-(4-ethynylphenyl)oxane
2-(4-ethynylphenyl)oxane (PubChem CID 139689024) has the molecular formula C13H14O
and a molecular weight of 186.25 g/mol. Its IUPAC name is 2-(4-ethynylphenyl)oxane.
Molecular Properties
| Compound Name | 2-(4-ethynylphenyl)oxane |
| PubChem CID | 139689024 |
| Molecular Formula | C13H14O |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 2-(4-ethynylphenyl)oxane |
| SMILES | C#Cc1ccc(C2CCCCO2)cc1 |
| InChI | InChI=1S/C13H14O/c1-2-11-6-8-12(9-7-11)13-5-3-4-10-14-13/h1,6-9,13H,3-5,10H2 |
| InChIKey | UOQATRFJPBDMQT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-ethynylphenyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethynylphenyl)oxane?
The IUPAC name of 2-(4-ethynylphenyl)oxane (CID 139689024) is 2-(4-ethynylphenyl)oxane.
What is the SMILES notation for 2-(4-ethynylphenyl)oxane?
The canonical SMILES for 2-(4-ethynylphenyl)oxane is C#Cc1ccc(C2CCCCO2)cc1.
What is the InChIKey of 2-(4-ethynylphenyl)oxane?
The InChIKey is UOQATRFJPBDMQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O/c1-2-11-6-8-12(9-7-11)13-5-3-4-10-14-13/h1,6-9,13H,3-5,10H2.
What are the key properties of 2-(4-ethynylphenyl)oxane?
2-(4-ethynylphenyl)oxane has a molecular weight of 186.25 g/mol, XLogP of 2.91, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethynylphenyl)oxane is sourced from PubChem (CID 139689024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).