About 4-ethenylphenol;2-(4-ethenylphenyl)oxane
4-ethenylphenol;2-(4-ethenylphenyl)oxane (PubChem CID 131719203) has the molecular formula C21H24O2
and a molecular weight of 308.42 g/mol. Its IUPAC name is 4-ethenylphenol;2-(4-ethenylphenyl)oxane.
Molecular Properties
| Compound Name | 4-ethenylphenol;2-(4-ethenylphenyl)oxane |
| PubChem CID | 131719203 |
| Molecular Formula | C21H24O2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 4-ethenylphenol;2-(4-ethenylphenyl)oxane |
| SMILES | C=Cc1ccc(C2CCCCO2)cc1.C=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C13H16O.C8H8O/c1-2-11-6-8-12(9-7-11)13-5-3-4-10-14-13;1-2-7-3-5-8(9)6-4-7/h2,6-9,13H,1,3-5,10H2;2-6,9H,1H2 |
| InChIKey | UUYAPNHBFGIHBI-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethenylphenol;2-(4-ethenylphenyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenylphenol;2-(4-ethenylphenyl)oxane?
The IUPAC name of 4-ethenylphenol;2-(4-ethenylphenyl)oxane (CID 131719203) is 4-ethenylphenol;2-(4-ethenylphenyl)oxane.
What is the SMILES notation for 4-ethenylphenol;2-(4-ethenylphenyl)oxane?
The canonical SMILES for 4-ethenylphenol;2-(4-ethenylphenyl)oxane is C=Cc1ccc(C2CCCCO2)cc1.C=Cc1ccc(O)cc1.
What is the InChIKey of 4-ethenylphenol;2-(4-ethenylphenyl)oxane?
The InChIKey is UUYAPNHBFGIHBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O.C8H8O/c1-2-11-6-8-12(9-7-11)13-5-3-4-10-14-13;1-2-7-3-5-8(9)6-4-7/h2,6-9,13H,1,3-5,10H2;2-6,9H,1H2.
What are the key properties of 4-ethenylphenol;2-(4-ethenylphenyl)oxane?
4-ethenylphenol;2-(4-ethenylphenyl)oxane has a molecular weight of 308.42 g/mol, XLogP of 5.61, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenylphenol;2-(4-ethenylphenyl)oxane is sourced from PubChem (CID 131719203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).