C12H12O2 — CID 12988134
2-(4-ethynylphenyl)-1,3-dioxane (PubChem CID 12988134) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-(4-ethynylphenyl)-1,3-dioxane.
| Compound Name | 2-(4-ethynylphenyl)-1,3-dioxane |
|---|---|
| PubChem CID | 12988134 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 2-(4-ethynylphenyl)-1,3-dioxane |
| SMILES | C#Cc1ccc(C2OCCCO2)cc1 |
| InChI | InChI=1S/C12H12O2/c1-2-10-4-6-11(7-5-10)12-13-8-3-9-14-12/h1,4-7,12H,3,8-9H2 |
| InChIKey | CTPUOIOIVOKZLQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|