About 2-(4-ethynylphenyl)-1,3-dioxane
2-(4-ethynylphenyl)-1,3-dioxane (PubChem CID 12988134) has the molecular formula C12H12O2
and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-(4-ethynylphenyl)-1,3-dioxane.
Molecular Properties
| Compound Name | 2-(4-ethynylphenyl)-1,3-dioxane |
| PubChem CID | 12988134 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 2-(4-ethynylphenyl)-1,3-dioxane |
| SMILES | C#Cc1ccc(C2OCCCO2)cc1 |
| InChI | InChI=1S/C12H12O2/c1-2-10-4-6-11(7-5-10)12-13-8-3-9-14-12/h1,4-7,12H,3,8-9H2 |
| InChIKey | CTPUOIOIVOKZLQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-ethynylphenyl)-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethynylphenyl)-1,3-dioxane?
The IUPAC name of 2-(4-ethynylphenyl)-1,3-dioxane (CID 12988134) is 2-(4-ethynylphenyl)-1,3-dioxane.
What is the SMILES notation for 2-(4-ethynylphenyl)-1,3-dioxane?
The canonical SMILES for 2-(4-ethynylphenyl)-1,3-dioxane is C#Cc1ccc(C2OCCCO2)cc1.
What is the InChIKey of 2-(4-ethynylphenyl)-1,3-dioxane?
The InChIKey is CTPUOIOIVOKZLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O2/c1-2-10-4-6-11(7-5-10)12-13-8-3-9-14-12/h1,4-7,12H,3,8-9H2.
What are the key properties of 2-(4-ethynylphenyl)-1,3-dioxane?
2-(4-ethynylphenyl)-1,3-dioxane has a molecular weight of 188.23 g/mol, XLogP of 2.10, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethynylphenyl)-1,3-dioxane is sourced from PubChem (CID 12988134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).