C10H11ClMgO2 — CID 169224785
magnesium;2-phenyl-1,3-dioxane;chloride (PubChem CID 169224785) has the molecular formula C10H11ClMgO2 and a molecular weight of 222.95 g/mol. Its IUPAC name is magnesium;2-phenyl-1,3-dioxane;chloride.
| Compound Name | magnesium;2-phenyl-1,3-dioxane;chloride |
|---|---|
| PubChem CID | 169224785 |
| Molecular Formula | C10H11ClMgO2 |
| Molecular Weight | 222.95 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | magnesium;2-phenyl-1,3-dioxane;chloride |
| SMILES | [Cl-].[Mg+2].[c-]1ccc(C2OCCCO2)cc1 |
| InChI | InChI=1S/C10H11O2.ClH.Mg/c1-2-5-9(6-3-1)10-11-7-4-8-12-10;;/h2-3,5-6,10H,4,7-8H2;1H;/q-1;;+2/p-1 |
| InChIKey | QZCJFYTZMIYSCC-UHFFFAOYSA-M |
| XLogP | -1.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.95 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|