C15H19BrFNO3S — CID 139689418
2-methylpropyl 2-(5-acetamido-2-bromo-4-fluorophenyl)sulfanylpropanoate (PubChem CID 139689418) has the molecular formula C15H19BrFNO3S and a molecular weight of 392.29 g/mol. Its IUPAC name is 2-methylpropyl 2-(5-acetamido-2-bromo-4-fluorophenyl)sulfanylpropanoate.
| Compound Name | 2-methylpropyl 2-(5-acetamido-2-bromo-4-fluorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 139689418 |
| Molecular Formula | C15H19BrFNO3S |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | 2-methylpropyl 2-(5-acetamido-2-bromo-4-fluorophenyl)sulfanylpropanoate |
| SMILES | CC(=O)Nc1cc(SC(C)C(=O)OCC(C)C)c(Br)cc1F |
| InChI | InChI=1S/C15H19BrFNO3S/c1-8(2)7-21-15(20)9(3)22-14-6-13(18-10(4)19)12(17)5-11(14)16/h5-6,8-9H,7H2,1-4H3,(H,18,19) |
| InChIKey | VEFISCUTUUIYOM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |