C16H21BrFNO3S — CID 139689454
butyl 2-(5-acetamido-2-bromo-4-fluorophenyl)sulfanylbutanoate (PubChem CID 139689454) has the molecular formula C16H21BrFNO3S and a molecular weight of 406.32 g/mol. Its IUPAC name is butyl 2-(5-acetamido-2-bromo-4-fluorophenyl)sulfanylbutanoate.
| Compound Name | butyl 2-(5-acetamido-2-bromo-4-fluorophenyl)sulfanylbutanoate |
|---|---|
| PubChem CID | 139689454 |
| Molecular Formula | C16H21BrFNO3S |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | butyl 2-(5-acetamido-2-bromo-4-fluorophenyl)sulfanylbutanoate |
| SMILES | CCCCOC(=O)C(CC)Sc1cc(NC(C)=O)c(F)cc1Br |
| InChI | InChI=1S/C16H21BrFNO3S/c1-4-6-7-22-16(21)14(5-2)23-15-9-13(19-10(3)20)12(18)8-11(15)17/h8-9,14H,4-7H2,1-3H3,(H,19,20) |
| InChIKey | CMLMBMLDZHPNLY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|