C18H25BrFNO3S — CID 139689447
propyl 2-[2-bromo-4-fluoro-5-(2-methylpropanoylamino)phenyl]sulfanylpentanoate (PubChem CID 139689447) has the molecular formula C18H25BrFNO3S and a molecular weight of 434.37 g/mol. Its IUPAC name is propyl 2-[2-bromo-4-fluoro-5-(2-methylpropanoylamino)phenyl]sulfanylpentanoate.
| Compound Name | propyl 2-[2-bromo-4-fluoro-5-(2-methylpropanoylamino)phenyl]sulfanylpentanoate |
|---|---|
| PubChem CID | 139689447 |
| Molecular Formula | C18H25BrFNO3S |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | propyl 2-[2-bromo-4-fluoro-5-(2-methylpropanoylamino)phenyl]sulfanylpentanoate |
| SMILES | CCCOC(=O)C(CCC)Sc1cc(NC(=O)C(C)C)c(F)cc1Br |
| InChI | InChI=1S/C18H25BrFNO3S/c1-5-7-15(18(23)24-8-6-2)25-16-10-14(13(20)9-12(16)19)21-17(22)11(3)4/h9-11,15H,5-8H2,1-4H3,(H,21,22) |
| InChIKey | AIIQVLUKAKHYJH-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |