C15H21F2NO2S — CID 139690218
butan-2-yl 2-(5-amino-2,4-difluorophenyl)sulfanylpentanoate (PubChem CID 139690218) has the molecular formula C15H21F2NO2S and a molecular weight of 317.40 g/mol. Its IUPAC name is butan-2-yl 2-(5-amino-2,4-difluorophenyl)sulfanylpentanoate.
| Compound Name | butan-2-yl 2-(5-amino-2,4-difluorophenyl)sulfanylpentanoate |
|---|---|
| PubChem CID | 139690218 |
| Molecular Formula | C15H21F2NO2S |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | butan-2-yl 2-(5-amino-2,4-difluorophenyl)sulfanylpentanoate |
| SMILES | CCCC(Sc1cc(N)c(F)cc1F)C(=O)OC(C)CC |
| InChI | InChI=1S/C15H21F2NO2S/c1-4-6-13(15(19)20-9(3)5-2)21-14-8-12(18)10(16)7-11(14)17/h7-9,13H,4-6,18H2,1-3H3 |
| InChIKey | VRDJNUPCKQAQFI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|