C22H38O5Si — CID 139690352
methyl 7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxo-2-(3-oxoprop-1-enyl)cyclopentyl]heptanoate (PubChem CID 139690352) has the molecular formula C22H38O5Si and a molecular weight of 410.63 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxo-2-(3-oxoprop-1-enyl)cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxo-2-(3-oxoprop-1-enyl)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 139690352 |
| Molecular Formula | C22H38O5Si |
| Molecular Weight | 410.63 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | methyl 7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxo-2-(3-oxoprop-1-enyl)cyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@H]1C(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C=CC=O |
| InChI | InChI=1S/C22H38O5Si/c1-22(2,3)28(5,6)27-20-16-19(24)17(18(20)13-11-15-23)12-9-7-8-10-14-21(25)26-4/h11,13,15,17-18,20H,7-10,12,14,16H2,1-6H3/t17-,18-,20-/m1/s1 |
| InChIKey | HRIPYCANEKKKOM-QWFCFKBJSA-N |
| XLogP | 4.85 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.63 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|