C10H12N4O2 — CID 139692715
2-[[5-(4-aminophenyl)-1H-1,2,4-triazol-3-yl]oxy]ethanol (PubChem CID 139692715) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is 2-[[5-(4-aminophenyl)-1H-1,2,4-triazol-3-yl]oxy]ethanol.
| Compound Name | 2-[[5-(4-aminophenyl)-1H-1,2,4-triazol-3-yl]oxy]ethanol |
|---|---|
| PubChem CID | 139692715 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 2-[[5-(4-aminophenyl)-1H-1,2,4-triazol-3-yl]oxy]ethanol |
| SMILES | Nc1ccc(-c2nc(OCCO)n[nH]2)cc1 |
| InChI | InChI=1S/C10H12N4O2/c11-8-3-1-7(2-4-8)9-12-10(14-13-9)16-6-5-15/h1-4,15H,5-6,11H2,(H,12,13,14) |
| InChIKey | HHEULPXFPSWZSB-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|