C17H32O3Si — CID 139693264
(E)-2-[(E)-but-1-enyl]-3-[tert-butyl(dimethyl)silyl]oxyhept-4-enoic acid (PubChem CID 139693264) has the molecular formula C17H32O3Si and a molecular weight of 312.53 g/mol. Its IUPAC name is (E)-2-[(E)-but-1-enyl]-3-[tert-butyl(dimethyl)silyl]oxyhept-4-enoic acid.
| Compound Name | (E)-2-[(E)-but-1-enyl]-3-[tert-butyl(dimethyl)silyl]oxyhept-4-enoic acid |
|---|---|
| PubChem CID | 139693264 |
| Molecular Formula | C17H32O3Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | (E)-2-[(E)-but-1-enyl]-3-[tert-butyl(dimethyl)silyl]oxyhept-4-enoic acid |
| SMILES | CC/C=C/C(O[Si](C)(C)C(C)(C)C)C(/C=C/CC)C(=O)O |
| InChI | InChI=1S/C17H32O3Si/c1-8-10-12-14(16(18)19)15(13-11-9-2)20-21(6,7)17(3,4)5/h10-15H,8-9H2,1-7H3,(H,18,19)/b12-10+,13-11+ |
| InChIKey | RISCCYWSVKDXET-DCIPZJNNSA-N |
| XLogP | 5.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|