C8H8Cl2N2O — CID 139696792
4,5-dichloro-2-(2-methylprop-1-enyl)pyridazin-3-one (PubChem CID 139696792) has the molecular formula C8H8Cl2N2O and a molecular weight of 219.07 g/mol. Its IUPAC name is 4,5-dichloro-2-(2-methylprop-1-enyl)pyridazin-3-one.
| Compound Name | 4,5-dichloro-2-(2-methylprop-1-enyl)pyridazin-3-one |
|---|---|
| PubChem CID | 139696792 |
| Molecular Formula | C8H8Cl2N2O |
| Molecular Weight | 219.07 g/mol |
| Exact Mass | 218.00 |
| IUPAC Name | 4,5-dichloro-2-(2-methylprop-1-enyl)pyridazin-3-one |
| SMILES | CC(C)=Cn1ncc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C8H8Cl2N2O/c1-5(2)4-12-8(13)7(10)6(9)3-11-12/h3-4H,1-2H3 |
| InChIKey | CBFIDIRLCOYVSY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.07 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |