C27H41BrFNO3S — CID 139701626
S-[5-[bis(2,3-dimethylpentanoyl)amino]-2-bromo-4-fluorophenyl] 2,3-dimethylpentanethioate (PubChem CID 139701626) has the molecular formula C27H41BrFNO3S and a molecular weight of 558.60 g/mol. Its IUPAC name is S-[5-[bis(2,3-dimethylpentanoyl)amino]-2-bromo-4-fluorophenyl] 2,3-dimethylpentanethioate.
| Compound Name | S-[5-[bis(2,3-dimethylpentanoyl)amino]-2-bromo-4-fluorophenyl] 2,3-dimethylpentanethioate |
|---|---|
| PubChem CID | 139701626 |
| Molecular Formula | C27H41BrFNO3S |
| Molecular Weight | 558.60 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | S-[5-[bis(2,3-dimethylpentanoyl)amino]-2-bromo-4-fluorophenyl] 2,3-dimethylpentanethioate |
| SMILES | CCC(C)C(C)C(=O)Sc1cc(N(C(=O)C(C)C(C)CC)C(=O)C(C)C(C)CC)c(F)cc1Br |
| InChI | InChI=1S/C27H41BrFNO3S/c1-10-15(4)18(7)25(31)30(26(32)19(8)16(5)11-2)23-14-24(21(28)13-22(23)29)34-27(33)20(9)17(6)12-3/h13-20H,10-12H2,1-9H3 |
| InChIKey | PIHUQJLKHLDMRZ-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.60 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|