C30H47BrFNO3S — CID 139701613
S-[5-[bis(2,3,3-trimethylpentanoyl)amino]-2-bromo-4-fluorophenyl] 2,3,3-trimethylpentanethioate (PubChem CID 139701613) has the molecular formula C30H47BrFNO3S and a molecular weight of 600.68 g/mol. Its IUPAC name is S-[5-[bis(2,3,3-trimethylpentanoyl)amino]-2-bromo-4-fluorophenyl] 2,3,3-trimethylpentanethioate.
| Compound Name | S-[5-[bis(2,3,3-trimethylpentanoyl)amino]-2-bromo-4-fluorophenyl] 2,3,3-trimethylpentanethioate |
|---|---|
| PubChem CID | 139701613 |
| Molecular Formula | C30H47BrFNO3S |
| Molecular Weight | 600.68 g/mol |
| Exact Mass | 599.24 |
| IUPAC Name | S-[5-[bis(2,3,3-trimethylpentanoyl)amino]-2-bromo-4-fluorophenyl] 2,3,3-trimethylpentanethioate |
| SMILES | CCC(C)(C)C(C)C(=O)Sc1cc(N(C(=O)C(C)C(C)(C)CC)C(=O)C(C)C(C)(C)CC)c(F)cc1Br |
| InChI | InChI=1S/C30H47BrFNO3S/c1-13-28(7,8)18(4)25(34)33(26(35)19(5)29(9,10)14-2)23-17-24(21(31)16-22(23)32)37-27(36)20(6)30(11,12)15-3/h16-20H,13-15H2,1-12H3 |
| InChIKey | LKSRGFRUVNPYMN-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.68 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|