C36H33ClN4O2S — CID 139703937
1-[[3-(4-chlorophenyl)-5-methyl-1-benzofuran-2-yl]methyl]-1-[[4-(dimethylamino)phenyl]methyl]-3-(6-methylsulfanylquinolin-5-yl)urea (PubChem CID 139703937) has the molecular formula C36H33ClN4O2S and a molecular weight of 621.21 g/mol. Its IUPAC name is 1-[[3-(4-chlorophenyl)-5-methyl-1-benzofuran-2-yl]methyl]-1-[[4-(dimethylamino)phenyl]methyl]-3-(6-methylsulfanylquinolin-5-yl)urea.
| Compound Name | 1-[[3-(4-chlorophenyl)-5-methyl-1-benzofuran-2-yl]methyl]-1-[[4-(dimethylamino)phenyl]methyl]-3-(6-methylsulfanylquinolin-5-yl)urea |
|---|---|
| PubChem CID | 139703937 |
| Molecular Formula | C36H33ClN4O2S |
| Molecular Weight | 621.21 g/mol |
| Exact Mass | 620.20 |
| IUPAC Name | 1-[[3-(4-chlorophenyl)-5-methyl-1-benzofuran-2-yl]methyl]-1-[[4-(dimethylamino)phenyl]methyl]-3-(6-methylsulfanylquinolin-5-yl)urea |
| SMILES | CSc1ccc2ncccc2c1NC(=O)N(Cc1ccc(N(C)C)cc1)Cc1oc2ccc(C)cc2c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C36H33ClN4O2S/c1-23-7-17-31-29(20-23)34(25-10-12-26(37)13-11-25)32(43-31)22-41(21-24-8-14-27(15-9-24)40(2)3)36(42)39-35-28-6-5-19-38-30(28)16-18-33(35)44-4/h5-20H,21-22H2,1-4H3,(H,39,42) |
| InChIKey | FHGQCJOFJRWAPU-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.21 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|