C32H34ClF3N2O2 — CID 67797309
1-[[3-(4-chlorophenyl)-5-methyl-1-benzofuran-2-yl]methyl]-1-nonyl-3-(2,4,6-trifluorophenyl)urea (PubChem CID 67797309) has the molecular formula C32H34ClF3N2O2 and a molecular weight of 571.08 g/mol. Its IUPAC name is 1-[[3-(4-chlorophenyl)-5-methyl-1-benzofuran-2-yl]methyl]-1-nonyl-3-(2,4,6-trifluorophenyl)urea.
| Compound Name | 1-[[3-(4-chlorophenyl)-5-methyl-1-benzofuran-2-yl]methyl]-1-nonyl-3-(2,4,6-trifluorophenyl)urea |
|---|---|
| PubChem CID | 67797309 |
| Molecular Formula | C32H34ClF3N2O2 |
| Molecular Weight | 571.08 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | 1-[[3-(4-chlorophenyl)-5-methyl-1-benzofuran-2-yl]methyl]-1-nonyl-3-(2,4,6-trifluorophenyl)urea |
| SMILES | CCCCCCCCCN(Cc1oc2ccc(C)cc2c1-c1ccc(Cl)cc1)C(=O)Nc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C32H34ClF3N2O2/c1-3-4-5-6-7-8-9-16-38(32(39)37-31-26(35)18-24(34)19-27(31)36)20-29-30(22-11-13-23(33)14-12-22)25-17-21(2)10-15-28(25)40-29/h10-15,17-19H,3-9,16,20H2,1-2H3,(H,37,39) |
| InChIKey | VLQRYIWUJILUPN-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.08 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|