C26H30F3N3O2 — CID 139657090
1-heptyl-1-[[1-(2-methoxyphenyl)pyrrol-2-yl]methyl]-3-(2,4,6-trifluorophenyl)urea (PubChem CID 139657090) has the molecular formula C26H30F3N3O2 and a molecular weight of 473.54 g/mol. Its IUPAC name is 1-heptyl-1-[[1-(2-methoxyphenyl)pyrrol-2-yl]methyl]-3-(2,4,6-trifluorophenyl)urea.
| Compound Name | 1-heptyl-1-[[1-(2-methoxyphenyl)pyrrol-2-yl]methyl]-3-(2,4,6-trifluorophenyl)urea |
|---|---|
| PubChem CID | 139657090 |
| Molecular Formula | C26H30F3N3O2 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 1-heptyl-1-[[1-(2-methoxyphenyl)pyrrol-2-yl]methyl]-3-(2,4,6-trifluorophenyl)urea |
| SMILES | CCCCCCCN(Cc1cccn1-c1ccccc1OC)C(=O)Nc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C26H30F3N3O2/c1-3-4-5-6-9-14-31(26(33)30-25-21(28)16-19(27)17-22(25)29)18-20-11-10-15-32(20)23-12-7-8-13-24(23)34-2/h7-8,10-13,15-17H,3-6,9,14,18H2,1-2H3,(H,30,33) |
| InChIKey | WRODQJDMDJWWRY-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|