C25H27ClF3N3O — CID 139657134
1-[(5-chloro-1-phenylpyrrol-2-yl)methyl]-1-heptyl-3-(2,4,6-trifluorophenyl)urea (PubChem CID 139657134) has the molecular formula C25H27ClF3N3O and a molecular weight of 477.96 g/mol. Its IUPAC name is 1-[(5-chloro-1-phenylpyrrol-2-yl)methyl]-1-heptyl-3-(2,4,6-trifluorophenyl)urea.
| Compound Name | 1-[(5-chloro-1-phenylpyrrol-2-yl)methyl]-1-heptyl-3-(2,4,6-trifluorophenyl)urea |
|---|---|
| PubChem CID | 139657134 |
| Molecular Formula | C25H27ClF3N3O |
| Molecular Weight | 477.96 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | 1-[(5-chloro-1-phenylpyrrol-2-yl)methyl]-1-heptyl-3-(2,4,6-trifluorophenyl)urea |
| SMILES | CCCCCCCN(Cc1ccc(Cl)n1-c1ccccc1)C(=O)Nc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C25H27ClF3N3O/c1-2-3-4-5-9-14-31(25(33)30-24-21(28)15-18(27)16-22(24)29)17-20-12-13-23(26)32(20)19-10-7-6-8-11-19/h6-8,10-13,15-16H,2-5,9,14,17H2,1H3,(H,30,33) |
| InChIKey | IKGFUBKNEULTQN-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.96 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|