C25H19F3N4O3 — CID 139657080
1-benzyl-1-[[1-(4-nitrophenyl)pyrrol-2-yl]methyl]-3-(2,4,6-trifluorophenyl)urea (PubChem CID 139657080) has the molecular formula C25H19F3N4O3 and a molecular weight of 480.45 g/mol. Its IUPAC name is 1-benzyl-1-[[1-(4-nitrophenyl)pyrrol-2-yl]methyl]-3-(2,4,6-trifluorophenyl)urea.
| Compound Name | 1-benzyl-1-[[1-(4-nitrophenyl)pyrrol-2-yl]methyl]-3-(2,4,6-trifluorophenyl)urea |
|---|---|
| PubChem CID | 139657080 |
| Molecular Formula | C25H19F3N4O3 |
| Molecular Weight | 480.45 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 1-benzyl-1-[[1-(4-nitrophenyl)pyrrol-2-yl]methyl]-3-(2,4,6-trifluorophenyl)urea |
| SMILES | O=C(Nc1c(F)cc(F)cc1F)N(Cc1ccccc1)Cc1cccn1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H19F3N4O3/c26-18-13-22(27)24(23(28)14-18)29-25(33)30(15-17-5-2-1-3-6-17)16-21-7-4-12-31(21)19-8-10-20(11-9-19)32(34)35/h1-14H,15-16H2,(H,29,33) |
| InChIKey | KENRZPKGTIXDHY-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 80.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.45 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|