C32H35N5O5 — CID 42771398
N-benzyl-N-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-2-[(4-nitrophenyl)carbamoyl-propan-2-ylamino]acetamide (PubChem CID 42771398) has the molecular formula C32H35N5O5 and a molecular weight of 569.66 g/mol. Its IUPAC name is N-benzyl-N-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-2-[(4-nitrophenyl)carbamoyl-propan-2-ylamino]acetamide.
| Compound Name | N-benzyl-N-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-2-[(4-nitrophenyl)carbamoyl-propan-2-ylamino]acetamide |
|---|---|
| PubChem CID | 42771398 |
| Molecular Formula | C32H35N5O5 |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | N-benzyl-N-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-2-[(4-nitrophenyl)carbamoyl-propan-2-ylamino]acetamide |
| SMILES | COc1cccc(Cn2cccc2CN(Cc2ccccc2)C(=O)CN(C(=O)Nc2ccc([N+](=O)[O-])cc2)C(C)C)c1 |
| InChI | InChI=1S/C32H35N5O5/c1-24(2)36(32(39)33-27-14-16-28(17-15-27)37(40)41)23-31(38)35(20-25-9-5-4-6-10-25)22-29-12-8-18-34(29)21-26-11-7-13-30(19-26)42-3/h4-19,24H,20-23H2,1-3H3,(H,33,39) |
| InChIKey | ZKSWDBKXAAENJK-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 109.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|