C28H23ClN4OS — CID 23355203
1-[4-(2-chlorophenyl)-6-ethylquinolin-3-yl]-3-(6-methylsulfanylquinolin-5-yl)urea (PubChem CID 23355203) has the molecular formula C28H23ClN4OS and a molecular weight of 499.04 g/mol. Its IUPAC name is 1-[4-(2-chlorophenyl)-6-ethylquinolin-3-yl]-3-(6-methylsulfanylquinolin-5-yl)urea.
| Compound Name | 1-[4-(2-chlorophenyl)-6-ethylquinolin-3-yl]-3-(6-methylsulfanylquinolin-5-yl)urea |
|---|---|
| PubChem CID | 23355203 |
| Molecular Formula | C28H23ClN4OS |
| Molecular Weight | 499.04 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | 1-[4-(2-chlorophenyl)-6-ethylquinolin-3-yl]-3-(6-methylsulfanylquinolin-5-yl)urea |
| SMILES | CCc1ccc2ncc(NC(=O)Nc3c(SC)ccc4ncccc34)c(-c3ccccc3Cl)c2c1 |
| InChI | InChI=1S/C28H23ClN4OS/c1-3-17-10-11-23-20(15-17)26(18-7-4-5-9-21(18)29)24(16-31-23)32-28(34)33-27-19-8-6-14-30-22(19)12-13-25(27)35-2/h4-16H,3H2,1-2H3,(H2,32,33,34) |
| InChIKey | MZLFQBLHRDHRFT-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.04 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |