C32H28FN3O7 — CID 139703990
3-[7-(6-fluoro-1,2-benzoxazol-3-yl)-2,3-dioxo-1,4-dioxa-10-azaspiro[4.5]decan-10-yl]propyl 5,6-dihydrobenzo[b][1]benzazepine-11-carboxylate (PubChem CID 139703990) has the molecular formula C32H28FN3O7 and a molecular weight of 585.59 g/mol. Its IUPAC name is 3-[7-(6-fluoro-1,2-benzoxazol-3-yl)-2,3-dioxo-1,4-dioxa-10-azaspiro[4.5]decan-10-yl]propyl 5,6-dihydrobenzo[b][1]benzazepine-11-carboxylate.
| Compound Name | 3-[7-(6-fluoro-1,2-benzoxazol-3-yl)-2,3-dioxo-1,4-dioxa-10-azaspiro[4.5]decan-10-yl]propyl 5,6-dihydrobenzo[b][1]benzazepine-11-carboxylate |
|---|---|
| PubChem CID | 139703990 |
| Molecular Formula | C32H28FN3O7 |
| Molecular Weight | 585.59 g/mol |
| Exact Mass | 585.19 |
| IUPAC Name | 3-[7-(6-fluoro-1,2-benzoxazol-3-yl)-2,3-dioxo-1,4-dioxa-10-azaspiro[4.5]decan-10-yl]propyl 5,6-dihydrobenzo[b][1]benzazepine-11-carboxylate |
| SMILES | O=C1OC2(CC(c3noc4cc(F)ccc34)CCN2CCCOC(=O)N2c3ccccc3CCc3ccccc32)OC1=O |
| InChI | InChI=1S/C32H28FN3O7/c33-23-12-13-24-27(18-23)43-34-28(24)22-14-16-35(32(19-22)41-29(37)30(38)42-32)15-5-17-40-31(39)36-25-8-3-1-6-20(25)10-11-21-7-2-4-9-26(21)36/h1-4,6-9,12-13,18,22H,5,10-11,14-17,19H2 |
| InChIKey | OMJXJYFMRIKNMQ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 111.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.59 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|