C25H30FN3O3 — CID 146669290
7-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propoxy]-2-methyl-3,4,5,6-tetrahydroisoquinolin-1-one (PubChem CID 146669290) has the molecular formula C25H30FN3O3 and a molecular weight of 439.53 g/mol. Its IUPAC name is 7-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propoxy]-2-methyl-3,4,5,6-tetrahydroisoquinolin-1-one.
| Compound Name | 7-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propoxy]-2-methyl-3,4,5,6-tetrahydroisoquinolin-1-one |
|---|---|
| PubChem CID | 146669290 |
| Molecular Formula | C25H30FN3O3 |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 7-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propoxy]-2-methyl-3,4,5,6-tetrahydroisoquinolin-1-one |
| SMILES | CN1CCC2=C(C=C(OCCCN3CCC(c4noc5cc(F)ccc45)CC3)CC2)C1=O |
| InChI | InChI=1S/C25H30FN3O3/c1-28-11-7-17-3-5-20(16-22(17)25(28)30)31-14-2-10-29-12-8-18(9-13-29)24-21-6-4-19(26)15-23(21)32-27-24/h4,6,15-16,18H,2-3,5,7-14H2,1H3 |
| InChIKey | GDBLNFUHOHZWSB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|