C29H28FN3O9 — CID 139703992
4-[7-(6-fluoro-1,2-benzoxazol-3-yl)-2,3-dioxo-1,4-dioxa-10-azaspiro[4.5]decan-10-yl]butyl 7,8-dihydro-6H-[1,3]dioxolo[4,5-g]quinoline-5-carboxylate (PubChem CID 139703992) has the molecular formula C29H28FN3O9 and a molecular weight of 581.55 g/mol. Its IUPAC name is 4-[7-(6-fluoro-1,2-benzoxazol-3-yl)-2,3-dioxo-1,4-dioxa-10-azaspiro[4.5]decan-10-yl]butyl 7,8-dihydro-6H-[1,3]dioxolo[4,5-g]quinoline-5-carboxylate.
| Compound Name | 4-[7-(6-fluoro-1,2-benzoxazol-3-yl)-2,3-dioxo-1,4-dioxa-10-azaspiro[4.5]decan-10-yl]butyl 7,8-dihydro-6H-[1,3]dioxolo[4,5-g]quinoline-5-carboxylate |
|---|---|
| PubChem CID | 139703992 |
| Molecular Formula | C29H28FN3O9 |
| Molecular Weight | 581.55 g/mol |
| Exact Mass | 581.18 |
| IUPAC Name | 4-[7-(6-fluoro-1,2-benzoxazol-3-yl)-2,3-dioxo-1,4-dioxa-10-azaspiro[4.5]decan-10-yl]butyl 7,8-dihydro-6H-[1,3]dioxolo[4,5-g]quinoline-5-carboxylate |
| SMILES | O=C1OC2(CC(c3noc4cc(F)ccc34)CCN2CCCCOC(=O)N2CCCc3cc4c(cc32)OCO4)OC1=O |
| InChI | InChI=1S/C29H28FN3O9/c30-19-5-6-20-22(13-19)42-31-25(20)18-7-10-32(29(15-18)40-26(34)27(35)41-29)8-1-2-11-37-28(36)33-9-3-4-17-12-23-24(14-21(17)33)39-16-38-23/h5-6,12-14,18H,1-4,7-11,15-16H2 |
| InChIKey | UUKJRVRBDARHJH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 129.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.55 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|