C33H28FN3O9 — CID 139703994
[3-[7-(6-fluoro-1,2-benzoxazol-3-yl)-2,3-dioxo-1,4-dioxa-10-azaspiro[4.5]decan-10-yl]-2-phenylpropyl] 6,7-dihydro-[1,3]dioxolo[4,5-f]indole-5-carboxylate (PubChem CID 139703994) has the molecular formula C33H28FN3O9 and a molecular weight of 629.60 g/mol. Its IUPAC name is [3-[7-(6-fluoro-1,2-benzoxazol-3-yl)-2,3-dioxo-1,4-dioxa-10-azaspiro[4.5]decan-10-yl]-2-phenylpropyl] 6,7-dihydro-[1,3]dioxolo[4,5-f]indole-5-carboxylate.
| Compound Name | [3-[7-(6-fluoro-1,2-benzoxazol-3-yl)-2,3-dioxo-1,4-dioxa-10-azaspiro[4.5]decan-10-yl]-2-phenylpropyl] 6,7-dihydro-[1,3]dioxolo[4,5-f]indole-5-carboxylate |
|---|---|
| PubChem CID | 139703994 |
| Molecular Formula | C33H28FN3O9 |
| Molecular Weight | 629.60 g/mol |
| Exact Mass | 629.18 |
| IUPAC Name | [3-[7-(6-fluoro-1,2-benzoxazol-3-yl)-2,3-dioxo-1,4-dioxa-10-azaspiro[4.5]decan-10-yl]-2-phenylpropyl] 6,7-dihydro-[1,3]dioxolo[4,5-f]indole-5-carboxylate |
| SMILES | O=C1OC2(CC(c3noc4cc(F)ccc34)CCN2CC(COC(=O)N2CCc3cc4c(cc32)OCO4)c2ccccc2)OC1=O |
| InChI | InChI=1S/C33H28FN3O9/c34-23-6-7-24-26(13-23)46-35-29(24)21-8-10-36(33(15-21)44-30(38)31(39)45-33)16-22(19-4-2-1-3-5-19)17-41-32(40)37-11-9-20-12-27-28(14-25(20)37)43-18-42-27/h1-7,12-14,21-22H,8-11,15-18H2 |
| InChIKey | AHQWAESLKNCYLN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 129.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.60 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|