C25H24ClN3O3 — CID 139704441
2-(6-chloro-1-phenylbenzimidazol-2-yl)-N-(2,6-diethoxyphenyl)acetamide (PubChem CID 139704441) has the molecular formula C25H24ClN3O3 and a molecular weight of 449.94 g/mol. Its IUPAC name is 2-(6-chloro-1-phenylbenzimidazol-2-yl)-N-(2,6-diethoxyphenyl)acetamide.
| Compound Name | 2-(6-chloro-1-phenylbenzimidazol-2-yl)-N-(2,6-diethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 139704441 |
| Molecular Formula | C25H24ClN3O3 |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 2-(6-chloro-1-phenylbenzimidazol-2-yl)-N-(2,6-diethoxyphenyl)acetamide |
| SMILES | CCOc1cccc(OCC)c1NC(=O)Cc1nc2ccc(Cl)cc2n1-c1ccccc1 |
| InChI | InChI=1S/C25H24ClN3O3/c1-3-31-21-11-8-12-22(32-4-2)25(21)28-24(30)16-23-27-19-14-13-17(26)15-20(19)29(23)18-9-6-5-7-10-18/h5-15H,3-4,16H2,1-2H3,(H,28,30) |
| InChIKey | XLEOBVNJHLQGFU-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |