C35H40IPSi — CID 139705505
iodo-[(1-pent-4-enyl-1-phenylsilinan-4-yl)methyl]-triphenyl-λ5-phosphane (PubChem CID 139705505) has the molecular formula C35H40IPSi and a molecular weight of 646.67 g/mol. Its IUPAC name is iodo-[(1-pent-4-enyl-1-phenylsilinan-4-yl)methyl]-triphenyl-λ5-phosphane.
| Compound Name | iodo-[(1-pent-4-enyl-1-phenylsilinan-4-yl)methyl]-triphenyl-λ5-phosphane |
|---|---|
| PubChem CID | 139705505 |
| Molecular Formula | C35H40IPSi |
| Molecular Weight | 646.67 g/mol |
| Exact Mass | 646.17 |
| IUPAC Name | iodo-[(1-pent-4-enyl-1-phenylsilinan-4-yl)methyl]-triphenyl-λ5-phosphane |
| SMILES | C=CCCC[Si]1(c2ccccc2)CCC(CP(I)(c2ccccc2)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C35H40IPSi/c1-2-3-16-27-38(35-23-14-7-15-24-35)28-25-31(26-29-38)30-37(36,32-17-8-4-9-18-32,33-19-10-5-11-20-33)34-21-12-6-13-22-34/h2,4-15,17-24,31H,1,3,16,25-30H2 |
| InChIKey | SHJFDVKQZVQGPV-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.67 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|