C21H22F2O5S2 — CID 139706500
2-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethylsulfanylmethyl]-2-(4-methylsulfonylphenyl)-1,3-dioxolane (PubChem CID 139706500) has the molecular formula C21H22F2O5S2 and a molecular weight of 456.53 g/mol. Its IUPAC name is 2-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethylsulfanylmethyl]-2-(4-methylsulfonylphenyl)-1,3-dioxolane.
| Compound Name | 2-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethylsulfanylmethyl]-2-(4-methylsulfonylphenyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 139706500 |
| Molecular Formula | C21H22F2O5S2 |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | 2-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethylsulfanylmethyl]-2-(4-methylsulfonylphenyl)-1,3-dioxolane |
| SMILES | CC(SCC1(c2ccc(S(C)(=O)=O)cc2)OCCO1)C1(c2ccc(F)cc2F)CO1 |
| InChI | InChI=1S/C21H22F2O5S2/c1-14(20(12-28-20)18-8-5-16(22)11-19(18)23)29-13-21(26-9-10-27-21)15-3-6-17(7-4-15)30(2,24)25/h3-8,11,14H,9-10,12-13H2,1-2H3 |
| InChIKey | DMUSWSDBYXHVPV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|