C20H23Cl2NO2 — CID 139707525
N-benzyl-2-(3,4-dichlorophenyl)-6-hydroxy-N-methylhexanamide (PubChem CID 139707525) has the molecular formula C20H23Cl2NO2 and a molecular weight of 380.32 g/mol. Its IUPAC name is N-benzyl-2-(3,4-dichlorophenyl)-6-hydroxy-N-methylhexanamide.
| Compound Name | N-benzyl-2-(3,4-dichlorophenyl)-6-hydroxy-N-methylhexanamide |
|---|---|
| PubChem CID | 139707525 |
| Molecular Formula | C20H23Cl2NO2 |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | N-benzyl-2-(3,4-dichlorophenyl)-6-hydroxy-N-methylhexanamide |
| SMILES | CN(Cc1ccccc1)C(=O)C(CCCCO)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H23Cl2NO2/c1-23(14-15-7-3-2-4-8-15)20(25)17(9-5-6-12-24)16-10-11-18(21)19(22)13-16/h2-4,7-8,10-11,13,17,24H,5-6,9,12,14H2,1H3 |
| InChIKey | UFTDZEKZQHSNIK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|