C14H10O7S — CID 139708501
[4-(hydroxymethoxy)-2,2-dioxo-1,3,2λ6-benzodioxathiol-5-yl]-phenylmethanone (PubChem CID 139708501) has the molecular formula C14H10O7S and a molecular weight of 322.29 g/mol. Its IUPAC name is [4-(hydroxymethoxy)-2,2-dioxo-1,3,2λ6-benzodioxathiol-5-yl]-phenylmethanone.
| Compound Name | [4-(hydroxymethoxy)-2,2-dioxo-1,3,2λ6-benzodioxathiol-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 139708501 |
| Molecular Formula | C14H10O7S |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | [4-(hydroxymethoxy)-2,2-dioxo-1,3,2λ6-benzodioxathiol-5-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccc2c(c1OCO)OS(=O)(=O)O2 |
| InChI | InChI=1S/C14H10O7S/c15-8-19-13-10(12(16)9-4-2-1-3-5-9)6-7-11-14(13)21-22(17,18)20-11/h1-7,15H,8H2 |
| InChIKey | URIMIJSIAVCAAO-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|