C36H42N2O2 — CID 139709062
4-[4-[4-[2-[4-(4-aminophenoxy)-3-methylphenyl]propan-2-yl]-1-methylcyclohexyl]-2-methylphenoxy]aniline (PubChem CID 139709062) has the molecular formula C36H42N2O2 and a molecular weight of 534.74 g/mol. Its IUPAC name is 4-[4-[4-[2-[4-(4-aminophenoxy)-3-methylphenyl]propan-2-yl]-1-methylcyclohexyl]-2-methylphenoxy]aniline.
| Compound Name | 4-[4-[4-[2-[4-(4-aminophenoxy)-3-methylphenyl]propan-2-yl]-1-methylcyclohexyl]-2-methylphenoxy]aniline |
|---|---|
| PubChem CID | 139709062 |
| Molecular Formula | C36H42N2O2 |
| Molecular Weight | 534.74 g/mol |
| Exact Mass | 534.32 |
| IUPAC Name | 4-[4-[4-[2-[4-(4-aminophenoxy)-3-methylphenyl]propan-2-yl]-1-methylcyclohexyl]-2-methylphenoxy]aniline |
| SMILES | Cc1cc(C2(C)CCC(C(C)(C)c3ccc(Oc4ccc(N)cc4)c(C)c3)CC2)ccc1Oc1ccc(N)cc1 |
| InChI | InChI=1S/C36H42N2O2/c1-24-22-27(6-16-33(24)39-31-12-8-29(37)9-13-31)35(3,4)26-18-20-36(5,21-19-26)28-7-17-34(25(2)23-28)40-32-14-10-30(38)11-15-32/h6-17,22-23,26H,18-21,37-38H2,1-5H3 |
| InChIKey | CXWVTEYPKFWGAA-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.74 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|