C23H26N4O2S — CID 139711806
N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-2-(5-pyridin-2-ylthiophen-2-yl)acetamide (PubChem CID 139711806) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-2-(5-pyridin-2-ylthiophen-2-yl)acetamide.
| Compound Name | N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-2-(5-pyridin-2-ylthiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 139711806 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-2-(5-pyridin-2-ylthiophen-2-yl)acetamide |
| SMILES | COc1ccc(NC(=O)Cc2ccc(-c3ccccn3)s2)cc1N1CCN(C)CC1 |
| InChI | InChI=1S/C23H26N4O2S/c1-26-11-13-27(14-12-26)20-15-17(6-8-21(20)29-2)25-23(28)16-18-7-9-22(30-18)19-5-3-4-10-24-19/h3-10,15H,11-14,16H2,1-2H3,(H,25,28) |
| InChIKey | BJRICHXTEXKKQD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |