C34H30BF12NO3 — CID 139712512
[2-bis[3-(trifluoromethyl)phenoxy]boranyloxy-6-(trifluoromethyl)phenyl]-triethylazanium;trifluoromethylbenzene (PubChem CID 139712512) has the molecular formula C34H30BF12NO3 and a molecular weight of 739.41 g/mol. Its IUPAC name is [2-bis[3-(trifluoromethyl)phenoxy]boranyloxy-6-(trifluoromethyl)phenyl]-triethylazanium;trifluoromethylbenzene.
| Compound Name | [2-bis[3-(trifluoromethyl)phenoxy]boranyloxy-6-(trifluoromethyl)phenyl]-triethylazanium;trifluoromethylbenzene |
|---|---|
| PubChem CID | 139712512 |
| Molecular Formula | C34H30BF12NO3 |
| Molecular Weight | 739.41 g/mol |
| Exact Mass | 739.21 |
| IUPAC Name | [2-bis[3-(trifluoromethyl)phenoxy]boranyloxy-6-(trifluoromethyl)phenyl]-triethylazanium;trifluoromethylbenzene |
| SMILES | CC[N+](CC)(CC)c1c(OB(Oc2cccc(C(F)(F)F)c2)Oc2cccc(C(F)(F)F)c2)cccc1C(F)(F)F.FC(F)(F)c1c[c-]ccc1 |
| InChI | InChI=1S/C27H26BF9NO3.C7H4F3/c1-4-38(5-2,6-3)24-22(27(35,36)37)14-9-15-23(24)41-28(39-20-12-7-10-18(16-20)25(29,30)31)40-21-13-8-11-19(17-21)26(32,33)34;8-7(9,10)6-4-2-1-3-5-6/h7-17H,4-6H2,1-3H3;1-2,4-5H/q+1;-1 |
| InChIKey | GSEFKGUJUICXFB-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.41 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|