C49H36BF12O3P — CID 140514550
bis[3-(trifluoromethyl)phenyl] [3-(trifluoromethyl)-2-[tris(3-methylphenyl)-[3-(trifluoromethyl)phenyl]-λ5-phosphanyl]phenyl] borate (PubChem CID 140514550) has the molecular formula C49H36BF12O3P and a molecular weight of 942.59 g/mol. Its IUPAC name is bis[3-(trifluoromethyl)phenyl] [3-(trifluoromethyl)-2-[tris(3-methylphenyl)-[3-(trifluoromethyl)phenyl]-λ5-phosphanyl]phenyl] borate.
| Compound Name | bis[3-(trifluoromethyl)phenyl] [3-(trifluoromethyl)-2-[tris(3-methylphenyl)-[3-(trifluoromethyl)phenyl]-λ5-phosphanyl]phenyl] borate |
|---|---|
| PubChem CID | 140514550 |
| Molecular Formula | C49H36BF12O3P |
| Molecular Weight | 942.59 g/mol |
| Exact Mass | 942.23 |
| IUPAC Name | bis[3-(trifluoromethyl)phenyl] [3-(trifluoromethyl)-2-[tris(3-methylphenyl)-[3-(trifluoromethyl)phenyl]-λ5-phosphanyl]phenyl] borate |
| SMILES | Cc1cccc(P(c2cccc(C)c2)(c2cccc(C)c2)(c2cccc(C(F)(F)F)c2)c2c(OB(Oc3cccc(C(F)(F)F)c3)Oc3cccc(C(F)(F)F)c3)cccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C49H36BF12O3P/c1-31-11-4-19-39(25-31)66(40-20-5-12-32(2)26-40,41-21-6-13-33(3)27-41,42-22-9-16-36(30-42)48(57,58)59)45-43(49(60,61)62)23-10-24-44(45)65-50(63-37-17-7-14-34(28-37)46(51,52)53)64-38-18-8-15-35(29-38)47(54,55)56/h4-30H,1-3H3 |
| InChIKey | RANLEEUKUCOXNA-UHFFFAOYSA-N |
| XLogP | 12.69 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 942.59 |
| LogP ≤ 5 | 12.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|