C26H33BF6NO3+ — CID 139812068
[1-bis[3-(trifluoromethyl)phenoxy]boranyloxycyclooctyl]methyl-trimethylazanium (PubChem CID 139812068) has the molecular formula C26H33BF6NO3+ and a molecular weight of 532.35 g/mol. Its IUPAC name is [1-bis[3-(trifluoromethyl)phenoxy]boranyloxycyclooctyl]methyl-trimethylazanium.
| Compound Name | [1-bis[3-(trifluoromethyl)phenoxy]boranyloxycyclooctyl]methyl-trimethylazanium |
|---|---|
| PubChem CID | 139812068 |
| Molecular Formula | C26H33BF6NO3+ |
| Molecular Weight | 532.35 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | [1-bis[3-(trifluoromethyl)phenoxy]boranyloxycyclooctyl]methyl-trimethylazanium |
| SMILES | C[N+](C)(C)CC1(OB(Oc2cccc(C(F)(F)F)c2)Oc2cccc(C(F)(F)F)c2)CCCCCCC1 |
| InChI | InChI=1S/C26H33BF6NO3/c1-34(2,3)19-24(15-7-5-4-6-8-16-24)37-27(35-22-13-9-11-20(17-22)25(28,29)30)36-23-14-10-12-21(18-23)26(31,32)33/h9-14,17-18H,4-8,15-16,19H2,1-3H3/q+1 |
| InChIKey | UEDIDTNWIJOBID-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.35 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|