C7H17ClN2S — CID 139719403
methyl N,N-diethyl-N'-methylcarbamimidothioate;hydrochloride (PubChem CID 139719403) has the molecular formula C7H17ClN2S and a molecular weight of 196.75 g/mol. Its IUPAC name is methyl N,N-diethyl-N'-methylcarbamimidothioate;hydrochloride.
| Compound Name | methyl N,N-diethyl-N'-methylcarbamimidothioate;hydrochloride |
|---|---|
| PubChem CID | 139719403 |
| Molecular Formula | C7H17ClN2S |
| Molecular Weight | 196.75 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | methyl N,N-diethyl-N'-methylcarbamimidothioate;hydrochloride |
| SMILES | CCN(CC)/C(=N/C)SC.Cl |
| InChI | InChI=1S/C7H16N2S.ClH/c1-5-9(6-2)7(8-3)10-4;/h5-6H2,1-4H3;1H/b8-7-; |
| InChIKey | NCMXYBOKEUMLPB-CFYXSCKTSA-N |
| XLogP | 2.10 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.75 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|