C13H8N4O — CID 139721047
3-(8-oxo-7H-imidazo[1,2-a]pyrazin-6-yl)benzonitrile (PubChem CID 139721047) has the molecular formula C13H8N4O and a molecular weight of 236.23 g/mol. Its IUPAC name is 3-(8-oxo-7H-imidazo[1,2-a]pyrazin-6-yl)benzonitrile.
| Compound Name | 3-(8-oxo-7H-imidazo[1,2-a]pyrazin-6-yl)benzonitrile |
|---|---|
| PubChem CID | 139721047 |
| Molecular Formula | C13H8N4O |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 3-(8-oxo-7H-imidazo[1,2-a]pyrazin-6-yl)benzonitrile |
| SMILES | N#Cc1cccc(-c2cn3ccnc3c(=O)[nH]2)c1 |
| InChI | InChI=1S/C13H8N4O/c14-7-9-2-1-3-10(6-9)11-8-17-5-4-15-12(17)13(18)16-11/h1-6,8H,(H,16,18) |
| InChIKey | NLSAVWNYUDNRIT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 73.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |