C23H45ClO2 — CID 139722506
3-[(Z)-18-chlorooctadec-8-enyl]pentane-1,5-diol (PubChem CID 139722506) has the molecular formula C23H45ClO2 and a molecular weight of 389.06 g/mol. Its IUPAC name is 3-[(Z)-18-chlorooctadec-8-enyl]pentane-1,5-diol.
| Compound Name | 3-[(Z)-18-chlorooctadec-8-enyl]pentane-1,5-diol |
|---|---|
| PubChem CID | 139722506 |
| Molecular Formula | C23H45ClO2 |
| Molecular Weight | 389.06 g/mol |
| Exact Mass | 388.31 |
| IUPAC Name | 3-[(Z)-18-chlorooctadec-8-enyl]pentane-1,5-diol |
| SMILES | OCCC(CCO)CCCCCCC/C=C\CCCCCCCCCCl |
| InChI | InChI=1S/C23H45ClO2/c24-20-16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-17-23(18-21-25)19-22-26/h1,3,23,25-26H,2,4-22H2/b3-1- |
| InChIKey | KWFAPNPQPDGLPV-IWQZZHSRSA-N |
| XLogP | 7.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.06 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|