C14H26O2 — CID 139726895
2,2,4,7-tetramethyldec-5-yne-4,7-diol (PubChem CID 139726895) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is 2,2,4,7-tetramethyldec-5-yne-4,7-diol.
| Compound Name | 2,2,4,7-tetramethyldec-5-yne-4,7-diol |
|---|---|
| PubChem CID | 139726895 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 2,2,4,7-tetramethyldec-5-yne-4,7-diol |
| SMILES | CCCC(C)(O)C#CC(C)(O)CC(C)(C)C |
| InChI | InChI=1S/C14H26O2/c1-7-8-13(5,15)9-10-14(6,16)11-12(2,3)4/h15-16H,7-8,11H2,1-6H3 |
| InChIKey | HKIARUDXNCXEFI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|