C46H18BF20IS2 — CID 139729215
bis[5-(4-methylphenyl)thiophen-2-yl]iodanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139729215) has the molecular formula C46H18BF20IS2 and a molecular weight of 1152.46 g/mol. Its IUPAC name is bis[5-(4-methylphenyl)thiophen-2-yl]iodanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | bis[5-(4-methylphenyl)thiophen-2-yl]iodanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139729215 |
| Molecular Formula | C46H18BF20IS2 |
| Molecular Weight | 1152.46 g/mol |
| Exact Mass | 1151.97 |
| IUPAC Name | bis[5-(4-methylphenyl)thiophen-2-yl]iodanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Cc1ccc(-c2ccc([I+]c3ccc(-c4ccc(C)cc4)s3)s2)cc1.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24BF20.C22H18IS2/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;1-15-3-7-17(8-4-15)19-11-13-21(24-19)23-22-14-12-20(25-22)18-9-5-16(2)6-10-18/h;3-14H,1-2H3/q-1;+1 |
| InChIKey | WSMNSSUPZBUWAK-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1152.46 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|