C28H50N4O4 — CID 139729354
2-[(3S,6S,11aS)-3-methyl-1,4,7-trioxo-2,3,5,6,9,10,11,11a-octahydropyrrolo[1,2-a][1,4,7]triazonin-6-yl]-N,N-bis(8-deuteriooctyl)acetamide (PubChem CID 139729354) has the molecular formula C28H50N4O4 and a molecular weight of 508.74 g/mol. Its IUPAC name is 2-[(3S,6S,11aS)-3-methyl-1,4,7-trioxo-2,3,5,6,9,10,11,11a-octahydropyrrolo[1,2-a][1,4,7]triazonin-6-yl]-N,N-bis(8-deuteriooctyl)acetamide.
| Compound Name | 2-[(3S,6S,11aS)-3-methyl-1,4,7-trioxo-2,3,5,6,9,10,11,11a-octahydropyrrolo[1,2-a][1,4,7]triazonin-6-yl]-N,N-bis(8-deuteriooctyl)acetamide |
|---|---|
| PubChem CID | 139729354 |
| Molecular Formula | C28H50N4O4 |
| Molecular Weight | 508.74 g/mol |
| Exact Mass | 508.40 |
| IUPAC Name | 2-[(3S,6S,11aS)-3-methyl-1,4,7-trioxo-2,3,5,6,9,10,11,11a-octahydropyrrolo[1,2-a][1,4,7]triazonin-6-yl]-N,N-bis(8-deuteriooctyl)acetamide |
| SMILES | [2H]CCCCCCCCN(CCCCCCCC[2H])C(=O)C[C@@H]1NC(=O)[C@H](C)NC(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C28H50N4O4/c1-4-6-8-10-12-14-18-31(19-15-13-11-9-7-5-2)25(33)21-23-28(36)32-20-16-17-24(32)27(35)29-22(3)26(34)30-23/h22-24H,4-21H2,1-3H3,(H,29,35)(H,30,34)/t22-,23-,24-/m0/s1/i1D,2D |
| InChIKey | WYXILVSJHCLATJ-XTSNWCPYSA-N |
| XLogP | 3.92 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.74 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|