C9H21ClN2 — CID 139730617
1,1-dimethyl-4-propylpiperazin-1-ium chloride (PubChem CID 139730617) has the molecular formula C9H21ClN2 and a molecular weight of 192.73 g/mol. Its IUPAC name is 1,1-dimethyl-4-propylpiperazin-1-ium chloride.
| Compound Name | 1,1-dimethyl-4-propylpiperazin-1-ium chloride |
|---|---|
| PubChem CID | 139730617 |
| Molecular Formula | C9H21ClN2 |
| Molecular Weight | 192.73 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 1,1-dimethyl-4-propylpiperazin-1-ium chloride |
| SMILES | CCCN1CC[N+](C)(C)CC1.[Cl-] |
| InChI | InChI=1S/C9H21N2.ClH/c1-4-5-10-6-8-11(2,3)9-7-10;/h4-9H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | LWWIMXVRIOWJJK-UHFFFAOYSA-M |
| XLogP | -2.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.73 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|