1,1-dimethyl-4-propylpiperazin-1-ium chloride

C9H21ClN2 — CID 139730617

IUPAC1,1-dimethyl-4-propylpiperazin-1-ium chloride
SMILESCCCN1CC[N+](C)(C)CC1.[Cl-]
InChIInChI=1S/C9H21N2.ClH/c1-4-5-10-6-8-11(2,3)9-7-10;/h4-9H2,1-3H3;1H/q+1;/p-1
InChIKeyLWWIMXVRIOWJJK-UHFFFAOYSA-M
MW192.73 g/mol
LogP-2.21
Rot. Bonds2

About 1,1-dimethyl-4-propylpiperazin-1-ium chloride

1,1-dimethyl-4-propylpiperazin-1-ium chloride (PubChem CID 139730617) has the molecular formula C9H21ClN2 and a molecular weight of 192.73 g/mol. Its IUPAC name is 1,1-dimethyl-4-propylpiperazin-1-ium chloride.

Molecular Properties

Compound Name1,1-dimethyl-4-propylpiperazin-1-ium chloride
PubChem CID139730617
Molecular FormulaC9H21ClN2
Molecular Weight192.73 g/mol
Exact Mass192.14
IUPAC Name1,1-dimethyl-4-propylpiperazin-1-ium chloride
SMILESCCCN1CC[N+](C)(C)CC1.[Cl-]
InChIInChI=1S/C9H21N2.ClH/c1-4-5-10-6-8-11(2,3)9-7-10;/h4-9H2,1-3H3;1H/q+1;/p-1
InChIKeyLWWIMXVRIOWJJK-UHFFFAOYSA-M
XLogP-2.21
TPSA3.24 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.73
LogP ≤ 5-2.21
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}

Analyze 1,1-dimethyl-4-propylpiperazin-1-ium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,1-dimethyl-4-propylpiperazin-1-ium chloride?
The IUPAC name of 1,1-dimethyl-4-propylpiperazin-1-ium chloride (CID 139730617) is 1,1-dimethyl-4-propylpiperazin-1-ium chloride.
What is the SMILES notation for 1,1-dimethyl-4-propylpiperazin-1-ium chloride?
The canonical SMILES for 1,1-dimethyl-4-propylpiperazin-1-ium chloride is CCCN1CC[N+](C)(C)CC1.[Cl-].
What is the InChIKey of 1,1-dimethyl-4-propylpiperazin-1-ium chloride?
The InChIKey is LWWIMXVRIOWJJK-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H21N2.ClH/c1-4-5-10-6-8-11(2,3)9-7-10;/h4-9H2,1-3H3;1H/q+1;/p-1.
What are the key properties of 1,1-dimethyl-4-propylpiperazin-1-ium chloride?
1,1-dimethyl-4-propylpiperazin-1-ium chloride has a molecular weight of 192.73 g/mol, XLogP of -2.21, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethyl-4-propylpiperazin-1-ium chloride is sourced from PubChem (CID 139730617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).