4-(2-chloroethyl)-1,1-dimethylpiperazin-1-ium chloride

C8H18Cl2N2 — CID 84819689

IUPAC4-(2-chloroethyl)-1,1-dimethylpiperazin-1-ium chloride
SMILESC[N+]1(C)CCN(CCCl)CC1.[Cl-]
InChIInChI=1S/C8H18ClN2.ClH/c1-11(2)7-5-10(4-3-9)6-8-11;/h3-8H2,1-2H3;1H/q+1;/p-1
InChIKeyCHMXVLFZEFVCTC-UHFFFAOYSA-M
MW213.15 g/mol
LogP-2.38
Rot. Bonds2

About 4-(2-chloroethyl)-1,1-dimethylpiperazin-1-ium chloride

4-(2-chloroethyl)-1,1-dimethylpiperazin-1-ium chloride (PubChem CID 84819689) has the molecular formula C8H18Cl2N2 and a molecular weight of 213.15 g/mol. Its IUPAC name is 4-(2-chloroethyl)-1,1-dimethylpiperazin-1-ium chloride.

Molecular Properties

Compound Name4-(2-chloroethyl)-1,1-dimethylpiperazin-1-ium chloride
PubChem CID84819689
Molecular FormulaC8H18Cl2N2
Molecular Weight213.15 g/mol
Exact Mass212.08
IUPAC Name4-(2-chloroethyl)-1,1-dimethylpiperazin-1-ium chloride
SMILESC[N+]1(C)CCN(CCCl)CC1.[Cl-]
InChIInChI=1S/C8H18ClN2.ClH/c1-11(2)7-5-10(4-3-9)6-8-11;/h3-8H2,1-2H3;1H/q+1;/p-1
InChIKeyCHMXVLFZEFVCTC-UHFFFAOYSA-M
XLogP-2.38
TPSA3.24 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.15
LogP ≤ 5-2.38
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}

Analyze 4-(2-chloroethyl)-1,1-dimethylpiperazin-1-ium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2-chloroethyl)-1,1-dimethylpiperazin-1-ium chloride?
The IUPAC name of 4-(2-chloroethyl)-1,1-dimethylpiperazin-1-ium chloride (CID 84819689) is 4-(2-chloroethyl)-1,1-dimethylpiperazin-1-ium chloride.
What is the SMILES notation for 4-(2-chloroethyl)-1,1-dimethylpiperazin-1-ium chloride?
The canonical SMILES for 4-(2-chloroethyl)-1,1-dimethylpiperazin-1-ium chloride is C[N+]1(C)CCN(CCCl)CC1.[Cl-].
What is the InChIKey of 4-(2-chloroethyl)-1,1-dimethylpiperazin-1-ium chloride?
The InChIKey is CHMXVLFZEFVCTC-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H18ClN2.ClH/c1-11(2)7-5-10(4-3-9)6-8-11;/h3-8H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 4-(2-chloroethyl)-1,1-dimethylpiperazin-1-ium chloride?
4-(2-chloroethyl)-1,1-dimethylpiperazin-1-ium chloride has a molecular weight of 213.15 g/mol, XLogP of -2.38, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chloroethyl)-1,1-dimethylpiperazin-1-ium chloride is sourced from PubChem (CID 84819689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).