C8H18Cl2N2 — CID 84819689
4-(2-chloroethyl)-1,1-dimethylpiperazin-1-ium chloride (PubChem CID 84819689) has the molecular formula C8H18Cl2N2 and a molecular weight of 213.15 g/mol. Its IUPAC name is 4-(2-chloroethyl)-1,1-dimethylpiperazin-1-ium chloride.
| Compound Name | 4-(2-chloroethyl)-1,1-dimethylpiperazin-1-ium chloride |
|---|---|
| PubChem CID | 84819689 |
| Molecular Formula | C8H18Cl2N2 |
| Molecular Weight | 213.15 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 4-(2-chloroethyl)-1,1-dimethylpiperazin-1-ium chloride |
| SMILES | C[N+]1(C)CCN(CCCl)CC1.[Cl-] |
| InChI | InChI=1S/C8H18ClN2.ClH/c1-11(2)7-5-10(4-3-9)6-8-11;/h3-8H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | CHMXVLFZEFVCTC-UHFFFAOYSA-M |
| XLogP | -2.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.15 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|